C14H15NO6 — CID 174758102
(Z)-3-(2,3-dimethyl-5-nitrophenyl)-4-ethoxy-4-oxobut-2-enoic acid (PubChem CID 174758102) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is (Z)-3-(2,3-dimethyl-5-nitrophenyl)-4-ethoxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-3-(2,3-dimethyl-5-nitrophenyl)-4-ethoxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 174758102 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (Z)-3-(2,3-dimethyl-5-nitrophenyl)-4-ethoxy-4-oxobut-2-enoic acid |
| SMILES | CCOC(=O)/C(=C\C(=O)O)c1cc([N+](=O)[O-])cc(C)c1C |
| InChI | InChI=1S/C14H15NO6/c1-4-21-14(18)12(7-13(16)17)11-6-10(15(19)20)5-8(2)9(11)3/h5-7H,4H2,1-3H3,(H,16,17)/b12-7- |
| InChIKey | KYKBSYUTFJWYJP-GHXNOFRVSA-N |
| XLogP | 2.24 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|