C12H18N2O3 — CID 71072786
1-(4-diazenyl-3,5-diethoxyphenyl)ethanol (PubChem CID 71072786) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(4-diazenyl-3,5-diethoxyphenyl)ethanol.
| Compound Name | 1-(4-diazenyl-3,5-diethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 71072786 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-(4-diazenyl-3,5-diethoxyphenyl)ethanol |
| SMILES | [H]/N=N/c1c(OCC)cc(C(C)O)cc1OCC |
| InChI | InChI=1S/C12H18N2O3/c1-4-16-10-6-9(8(3)15)7-11(17-5-2)12(10)14-13/h6-8,13,15H,4-5H2,1-3H3/b14-13+ |
| InChIKey | DKLJKZOWGYFFOR-BUHFOSPRSA-N |
| XLogP | 3.20 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|