C21H28N2O5 — CID 126610805
(2-butoxy-4-methoxy-3-methylphenyl)-(3,4,5-trimethoxyphenyl)diazene (PubChem CID 126610805) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is (2-butoxy-4-methoxy-3-methylphenyl)-(3,4,5-trimethoxyphenyl)diazene.
| Compound Name | (2-butoxy-4-methoxy-3-methylphenyl)-(3,4,5-trimethoxyphenyl)diazene |
|---|---|
| PubChem CID | 126610805 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (2-butoxy-4-methoxy-3-methylphenyl)-(3,4,5-trimethoxyphenyl)diazene |
| SMILES | CCCCOc1c(/N=N/c2cc(OC)c(OC)c(OC)c2)ccc(OC)c1C |
| InChI | InChI=1S/C21H28N2O5/c1-7-8-11-28-20-14(2)17(24-3)10-9-16(20)23-22-15-12-18(25-4)21(27-6)19(13-15)26-5/h9-10,12-13H,7-8,11H2,1-6H3/b23-22+ |
| InChIKey | ZZLPDPVEHBPKIJ-GHVJWSGMSA-N |
| XLogP | 5.62 |
| TPSA | 70.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|