C16H17FN2O4 — CID 118484582
(3-fluoro-4-methoxyphenyl)-(3,4,5-trimethoxyphenyl)diazene (PubChem CID 118484582) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-(3,4,5-trimethoxyphenyl)diazene.
| Compound Name | (3-fluoro-4-methoxyphenyl)-(3,4,5-trimethoxyphenyl)diazene |
|---|---|
| PubChem CID | 118484582 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-(3,4,5-trimethoxyphenyl)diazene |
| SMILES | COc1ccc(/N=N/c2cc(OC)c(OC)c(OC)c2)cc1F |
| InChI | InChI=1S/C16H17FN2O4/c1-20-13-6-5-10(7-12(13)17)18-19-11-8-14(21-2)16(23-4)15(9-11)22-3/h5-9H,1-4H3/b19-18+ |
| InChIKey | QSSAYCVDXRQACT-VHEBQXMUSA-N |
| XLogP | 4.28 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|