C15H17N3O5 — CID 118484581
(6-methoxy-1-oxidopyridin-1-ium-3-yl)-(3,4,5-trimethoxyphenyl)diazene (PubChem CID 118484581) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is (6-methoxy-1-oxidopyridin-1-ium-3-yl)-(3,4,5-trimethoxyphenyl)diazene.
| Compound Name | (6-methoxy-1-oxidopyridin-1-ium-3-yl)-(3,4,5-trimethoxyphenyl)diazene |
|---|---|
| PubChem CID | 118484581 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (6-methoxy-1-oxidopyridin-1-ium-3-yl)-(3,4,5-trimethoxyphenyl)diazene |
| SMILES | COc1cc(/N=N/c2ccc(OC)[n+]([O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C15H17N3O5/c1-20-12-7-11(8-13(21-2)15(12)23-4)17-16-10-5-6-14(22-3)18(19)9-10/h5-9H,1-4H3/b17-16+ |
| InChIKey | CCCXCMRGHQNQTO-WUKNDPDISA-N |
| XLogP | 2.77 |
| TPSA | 88.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|