C23H26N6O5 — CID 2450300
5-amino-4-(1H-benzimidazol-2-yl)-1-(2-methoxyethyl)-2-[(3,4,5-trimethoxyphenyl)diazenyl]pyrrol-3-ol (PubChem CID 2450300) has the molecular formula C23H26N6O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is 5-amino-4-(1H-benzimidazol-2-yl)-1-(2-methoxyethyl)-2-[(3,4,5-trimethoxyphenyl)diazenyl]pyrrol-3-ol.
| Compound Name | 5-amino-4-(1H-benzimidazol-2-yl)-1-(2-methoxyethyl)-2-[(3,4,5-trimethoxyphenyl)diazenyl]pyrrol-3-ol |
|---|---|
| PubChem CID | 2450300 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 5-amino-4-(1H-benzimidazol-2-yl)-1-(2-methoxyethyl)-2-[(3,4,5-trimethoxyphenyl)diazenyl]pyrrol-3-ol |
| SMILES | COCCn1c(N)c(-c2nc3ccccc3[nH]2)c(O)c1/N=N/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H26N6O5/c1-31-10-9-29-21(24)18(22-25-14-7-5-6-8-15(14)26-22)19(30)23(29)28-27-13-11-16(32-2)20(34-4)17(12-13)33-3/h5-8,11-12,30H,9-10,24H2,1-4H3,(H,25,26)/b28-27+ |
| InChIKey | LFJBZSNHDYLLSR-BYYHNAKLSA-N |
| XLogP | 4.41 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|