C7H6O3 — CID 169438397
3,5-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde (PubChem CID 169438397) has the molecular formula C7H6O3 and a molecular weight of 144.08 g/mol. Its IUPAC name is 3,5-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde.
| Compound Name | 3,5-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 169438397 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 144.08 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 3,5-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbaldehyde |
| SMILES | O=C[13c]1[13cH][13c](O)[13cH][13c](O)[13cH]1 |
| InChI | InChI=1S/C7H6O3/c8-4-5-1-6(9)3-7(10)2-5/h1-4,9-10H/i1+1,2+1,3+1,5+1,6+1,7+1 |
| InChIKey | HAQLHRYUDBKTJG-JTZKEMBVSA-N |
| XLogP | 0.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.08 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|