C12H10O9S — CID 15126366
[4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenyl] hydrogen sulfate (PubChem CID 15126366) has the molecular formula C12H10O9S and a molecular weight of 330.27 g/mol. Its IUPAC name is [4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenyl] hydrogen sulfate.
| Compound Name | [4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 15126366 |
| Molecular Formula | C12H10O9S |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | [4-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1cc(O)c(Oc2cc(O)cc(O)c2)c(O)c1 |
| InChI | InChI=1S/C12H10O9S/c13-6-1-7(14)3-8(2-6)20-12-10(15)4-9(5-11(12)16)21-22(17,18)19/h1-5,13-16H,(H,17,18,19) |
| InChIKey | MXUYHVDBRGUZBB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|