C11H14O3 — CID 144789382
5-pent-4-enoxybenzene-1,3-diol (PubChem CID 144789382) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-pent-4-enoxybenzene-1,3-diol.
| Compound Name | 5-pent-4-enoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 144789382 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-pent-4-enoxybenzene-1,3-diol |
| SMILES | C=CCCCOc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H14O3/c1-2-3-4-5-14-11-7-9(12)6-10(13)8-11/h2,6-8,12-13H,1,3-5H2 |
| InChIKey | OPIGVCIJNYPPKU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|