About 5-pent-4-enoxybenzene-1,3-diol
5-pent-4-enoxybenzene-1,3-diol (PubChem CID 144789382) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-pent-4-enoxybenzene-1,3-diol.
Molecular Properties
| Compound Name | 5-pent-4-enoxybenzene-1,3-diol |
| PubChem CID | 144789382 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-pent-4-enoxybenzene-1,3-diol |
| SMILES | C=CCCCOc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H14O3/c1-2-3-4-5-14-11-7-9(12)6-10(13)8-11/h2,6-8,12-13H,1,3-5H2 |
| InChIKey | OPIGVCIJNYPPKU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-pent-4-enoxybenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pent-4-enoxybenzene-1,3-diol?
The IUPAC name of 5-pent-4-enoxybenzene-1,3-diol (CID 144789382) is 5-pent-4-enoxybenzene-1,3-diol.
What is the SMILES notation for 5-pent-4-enoxybenzene-1,3-diol?
The canonical SMILES for 5-pent-4-enoxybenzene-1,3-diol is C=CCCCOc1cc(O)cc(O)c1.
What is the InChIKey of 5-pent-4-enoxybenzene-1,3-diol?
The InChIKey is OPIGVCIJNYPPKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-3-4-5-14-11-7-9(12)6-10(13)8-11/h2,6-8,12-13H,1,3-5H2.
What are the key properties of 5-pent-4-enoxybenzene-1,3-diol?
5-pent-4-enoxybenzene-1,3-diol has a molecular weight of 194.23 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pent-4-enoxybenzene-1,3-diol is sourced from PubChem (CID 144789382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).