C16H19F6NO2 — CID 123476859
N-[2-[3,5-bis(trifluoromethyl)phenoxy]ethyl]-3-methylpentanamide (PubChem CID 123476859) has the molecular formula C16H19F6NO2 and a molecular weight of 371.32 g/mol. Its IUPAC name is N-[2-[3,5-bis(trifluoromethyl)phenoxy]ethyl]-3-methylpentanamide.
| Compound Name | N-[2-[3,5-bis(trifluoromethyl)phenoxy]ethyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 123476859 |
| Molecular Formula | C16H19F6NO2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[2-[3,5-bis(trifluoromethyl)phenoxy]ethyl]-3-methylpentanamide |
| SMILES | CCC(C)CC(=O)NCCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F6NO2/c1-3-10(2)6-14(24)23-4-5-25-13-8-11(15(17,18)19)7-12(9-13)16(20,21)22/h7-10H,3-6H2,1-2H3,(H,23,24) |
| InChIKey | NPPAECUDXRYJHJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|