C15H19F3N2O4 — CID 119912627
2-[methyl-[2-oxo-2-[2-[3-(trifluoromethyl)phenoxy]ethylamino]ethyl]amino]propanoic acid (PubChem CID 119912627) has the molecular formula C15H19F3N2O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-[methyl-[2-oxo-2-[2-[3-(trifluoromethyl)phenoxy]ethylamino]ethyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[2-oxo-2-[2-[3-(trifluoromethyl)phenoxy]ethylamino]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119912627 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[methyl-[2-oxo-2-[2-[3-(trifluoromethyl)phenoxy]ethylamino]ethyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)CC(=O)NCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O4/c1-10(14(22)23)20(2)9-13(21)19-6-7-24-12-5-3-4-11(8-12)15(16,17)18/h3-5,8,10H,6-7,9H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | BBXIVZNPECHTPG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|