C19H22ClF3N2O2 — CID 119736709
3-amino-2-methyl-3-phenyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide;hydrochloride (PubChem CID 119736709) has the molecular formula C19H22ClF3N2O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is 3-amino-2-methyl-3-phenyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide;hydrochloride.
| Compound Name | 3-amino-2-methyl-3-phenyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119736709 |
| Molecular Formula | C19H22ClF3N2O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-amino-2-methyl-3-phenyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide;hydrochloride |
| SMILES | CC(C(=O)NCCOc1cccc(C(F)(F)F)c1)C(N)c1ccccc1.Cl |
| InChI | InChI=1S/C19H21F3N2O2.ClH/c1-13(17(23)14-6-3-2-4-7-14)18(25)24-10-11-26-16-9-5-8-15(12-16)19(20,21)22;/h2-9,12-13,17H,10-11,23H2,1H3,(H,24,25);1H |
| InChIKey | QMHDYFZXYVBJCW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|