C19H20F3NO2 — CID 85462760
2-phenyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]butanamide (PubChem CID 85462760) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-phenyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]butanamide.
| Compound Name | 2-phenyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 85462760 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-phenyl-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]butanamide |
| SMILES | CCC(C(=O)NCCOc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H20F3NO2/c1-2-17(14-7-4-3-5-8-14)18(24)23-11-12-25-16-10-6-9-15(13-16)19(20,21)22/h3-10,13,17H,2,11-12H2,1H3,(H,23,24) |
| InChIKey | LBBJOATYRLRNSC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|