C14H18F4N2O2 — CID 118661024
(2R)-2-amino-N-[2-[3-fluoro-5-(trifluoromethyl)phenoxy]ethyl]-3-methylbutanamide (PubChem CID 118661024) has the molecular formula C14H18F4N2O2 and a molecular weight of 322.30 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-[3-fluoro-5-(trifluoromethyl)phenoxy]ethyl]-3-methylbutanamide.
| Compound Name | (2R)-2-amino-N-[2-[3-fluoro-5-(trifluoromethyl)phenoxy]ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 118661024 |
| Molecular Formula | C14H18F4N2O2 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (2R)-2-amino-N-[2-[3-fluoro-5-(trifluoromethyl)phenoxy]ethyl]-3-methylbutanamide |
| SMILES | CC(C)[C@@H](N)C(=O)NCCOc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F4N2O2/c1-8(2)12(19)13(21)20-3-4-22-11-6-9(14(16,17)18)5-10(15)7-11/h5-8,12H,3-4,19H2,1-2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | IDQOEYRLNMAXAC-GFCCVEGCSA-N |
| XLogP | 2.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|