C20H19F7N2O2 — CID 118661186
(2S)-2-amino-N-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]-3-(3-fluorophenyl)propanamide (PubChem CID 118661186) has the molecular formula C20H19F7N2O2 and a molecular weight of 452.37 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]-3-(3-fluorophenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]-3-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 118661186 |
| Molecular Formula | C20H19F7N2O2 |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (2S)-2-amino-N-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]-3-(3-fluorophenyl)propanamide |
| SMILES | N[C@@H](Cc1cccc(F)c1)C(=O)NCCCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F7N2O2/c21-15-4-1-3-12(7-15)8-17(28)18(30)29-5-2-6-31-16-10-13(19(22,23)24)9-14(11-16)20(25,26)27/h1,3-4,7,9-11,17H,2,5-6,8,28H2,(H,29,30)/t17-/m0/s1 |
| InChIKey | VJMMQGBWRQQYBZ-KRWDZBQOSA-N |
| XLogP | 4.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|