C31H48O2 — CID 59780438
4-[(7S,11R)-2-(4-hydroxyphenyl)-7,11,15-trimethylhexadecyl]phenol (PubChem CID 59780438) has the molecular formula C31H48O2 and a molecular weight of 452.72 g/mol. Its IUPAC name is 4-[(7S,11R)-2-(4-hydroxyphenyl)-7,11,15-trimethylhexadecyl]phenol.
| Compound Name | 4-[(7S,11R)-2-(4-hydroxyphenyl)-7,11,15-trimethylhexadecyl]phenol |
|---|---|
| PubChem CID | 59780438 |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | 4-[(7S,11R)-2-(4-hydroxyphenyl)-7,11,15-trimethylhexadecyl]phenol |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCCCC(Cc1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H48O2/c1-24(2)9-7-11-26(4)13-8-12-25(3)10-5-6-14-29(28-17-21-31(33)22-18-28)23-27-15-19-30(32)20-16-27/h15-22,24-26,29,32-33H,5-14,23H2,1-4H3/t25-,26+,29?/m0/s1 |
| InChIKey | QXNKEDBUSCUIHR-YTUWVCBBSA-N |
| XLogP | 9.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|