C18H30O — CID 155208815
4-(2,6,8-trimethylnonyl)phenol (PubChem CID 155208815) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-(2,6,8-trimethylnonyl)phenol.
| Compound Name | 4-(2,6,8-trimethylnonyl)phenol |
|---|---|
| PubChem CID | 155208815 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 4-(2,6,8-trimethylnonyl)phenol |
| SMILES | CC(C)CC(C)CCCC(C)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H30O/c1-14(2)12-15(3)6-5-7-16(4)13-17-8-10-18(19)11-9-17/h8-11,14-16,19H,5-7,12-13H2,1-4H3 |
| InChIKey | AREHMALIODIDEQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |