C17H27F — CID 162726877
1-(2,8-dimethylnonyl)-4-fluorobenzene (PubChem CID 162726877) has the molecular formula C17H27F and a molecular weight of 250.40 g/mol. Its IUPAC name is 1-(2,8-dimethylnonyl)-4-fluorobenzene.
| Compound Name | 1-(2,8-dimethylnonyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 162726877 |
| Molecular Formula | C17H27F |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 1-(2,8-dimethylnonyl)-4-fluorobenzene |
| SMILES | CC(C)CCCCCC(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H27F/c1-14(2)7-5-4-6-8-15(3)13-16-9-11-17(18)12-10-16/h9-12,14-15H,4-8,13H2,1-3H3 |
| InChIKey | RCCHRSYVQLMTOM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|