C19H33F — CID 162726876
1-(2,8-dimethylnonyl)-4-fluorobenzene;ethane (PubChem CID 162726876) has the molecular formula C19H33F and a molecular weight of 280.47 g/mol. Its IUPAC name is 1-(2,8-dimethylnonyl)-4-fluorobenzene;ethane.
| Compound Name | 1-(2,8-dimethylnonyl)-4-fluorobenzene;ethane |
|---|---|
| PubChem CID | 162726876 |
| Molecular Formula | C19H33F |
| Molecular Weight | 280.47 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 1-(2,8-dimethylnonyl)-4-fluorobenzene;ethane |
| SMILES | CC.CC(C)CCCCCC(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H27F.C2H6/c1-14(2)7-5-4-6-8-15(3)13-16-9-11-17(18)12-10-16;1-2/h9-12,14-15H,4-8,13H2,1-3H3;1-2H3 |
| InChIKey | DAQZPQQATVXKNS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.47 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|