C17H28FN — CID 83169392
N-ethyl-2-[(4-fluorophenyl)methyl]-6-methylheptan-1-amine (PubChem CID 83169392) has the molecular formula C17H28FN and a molecular weight of 265.42 g/mol. Its IUPAC name is N-ethyl-2-[(4-fluorophenyl)methyl]-6-methylheptan-1-amine.
| Compound Name | N-ethyl-2-[(4-fluorophenyl)methyl]-6-methylheptan-1-amine |
|---|---|
| PubChem CID | 83169392 |
| Molecular Formula | C17H28FN |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | N-ethyl-2-[(4-fluorophenyl)methyl]-6-methylheptan-1-amine |
| SMILES | CCNCC(CCCC(C)C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H28FN/c1-4-19-13-16(7-5-6-14(2)3)12-15-8-10-17(18)11-9-15/h8-11,14,16,19H,4-7,12-13H2,1-3H3 |
| InChIKey | HEPOGAPEXWSGSI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |