C12H20N2O — CID 116932463
1-(5-ethyl-2-methoxyphenyl)-N'-methylethane-1,2-diamine (PubChem CID 116932463) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(5-ethyl-2-methoxyphenyl)-N'-methylethane-1,2-diamine.
| Compound Name | 1-(5-ethyl-2-methoxyphenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 116932463 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(5-ethyl-2-methoxyphenyl)-N'-methylethane-1,2-diamine |
| SMILES | CCc1ccc(OC)c(C(N)CNC)c1 |
| InChI | InChI=1S/C12H20N2O/c1-4-9-5-6-12(15-3)10(7-9)11(13)8-14-2/h5-7,11,14H,4,8,13H2,1-3H3 |
| InChIKey | FVOVMXSTKAWYOP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |