C12H19NOS — CID 116831240
3-amino-3-(5-ethyl-2-methoxyphenyl)propane-1-thiol (PubChem CID 116831240) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 3-amino-3-(5-ethyl-2-methoxyphenyl)propane-1-thiol.
| Compound Name | 3-amino-3-(5-ethyl-2-methoxyphenyl)propane-1-thiol |
|---|---|
| PubChem CID | 116831240 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-amino-3-(5-ethyl-2-methoxyphenyl)propane-1-thiol |
| SMILES | CCc1ccc(OC)c(C(N)CCS)c1 |
| InChI | InChI=1S/C12H19NOS/c1-3-9-4-5-12(14-2)10(8-9)11(13)6-7-15/h4-5,8,11,15H,3,6-7,13H2,1-2H3 |
| InChIKey | UYHKZVUTQVSYKY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|