C24H22N4O2S — CID 55970055
N-[1-oxo-3-phenyl-1-[4-(pyrazol-1-ylmethyl)anilino]propan-2-yl]thiophene-2-carboxamide (PubChem CID 55970055) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[1-oxo-3-phenyl-1-[4-(pyrazol-1-ylmethyl)anilino]propan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-oxo-3-phenyl-1-[4-(pyrazol-1-ylmethyl)anilino]propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55970055 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[1-oxo-3-phenyl-1-[4-(pyrazol-1-ylmethyl)anilino]propan-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)Nc1ccc(Cn2cccn2)cc1)c1cccs1 |
| InChI | InChI=1S/C24H22N4O2S/c29-23(26-20-11-9-19(10-12-20)17-28-14-5-13-25-28)21(16-18-6-2-1-3-7-18)27-24(30)22-8-4-15-31-22/h1-15,21H,16-17H2,(H,26,29)(H,27,30) |
| InChIKey | WENPZGSNUHOCTP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |