C14H18ClNO2 — CID 71444012
N-[3-(furan-2-yl)propyl]-4-methoxyaniline;hydrochloride (PubChem CID 71444012) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is N-[3-(furan-2-yl)propyl]-4-methoxyaniline;hydrochloride.
| Compound Name | N-[3-(furan-2-yl)propyl]-4-methoxyaniline;hydrochloride |
|---|---|
| PubChem CID | 71444012 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[3-(furan-2-yl)propyl]-4-methoxyaniline;hydrochloride |
| SMILES | COc1ccc(NCCCc2ccco2)cc1.Cl |
| InChI | InChI=1S/C14H17NO2.ClH/c1-16-13-8-6-12(7-9-13)15-10-2-4-14-5-3-11-17-14;/h3,5-9,11,15H,2,4,10H2,1H3;1H |
| InChIKey | IEXIWXZJNVSRBM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|