C13H20BrClN2O3S — CID 119963828
[1-(2-bromo-5-methoxyphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride (PubChem CID 119963828) has the molecular formula C13H20BrClN2O3S and a molecular weight of 399.74 g/mol. Its IUPAC name is [1-(2-bromo-5-methoxyphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride.
| Compound Name | [1-(2-bromo-5-methoxyphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119963828 |
| Molecular Formula | C13H20BrClN2O3S |
| Molecular Weight | 399.74 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | [1-(2-bromo-5-methoxyphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride |
| SMILES | COc1ccc(Br)c(S(=O)(=O)N2CCC(CN)CC2)c1.Cl |
| InChI | InChI=1S/C13H19BrN2O3S.ClH/c1-19-11-2-3-12(14)13(8-11)20(17,18)16-6-4-10(9-15)5-7-16;/h2-3,8,10H,4-7,9,15H2,1H3;1H |
| InChIKey | LOSXHTQDDXEVLJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |