C21H27N3O5S — CID 55919176
N-methoxy-3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-N-methylbenzenesulfonamide (PubChem CID 55919176) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-methoxy-3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-N-methylbenzenesulfonamide.
| Compound Name | N-methoxy-3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55919176 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-methoxy-3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCCN(C(=O)c3cccc(S(=O)(=O)N(C)OC)c3)CC2)cc1 |
| InChI | InChI=1S/C21H27N3O5S/c1-22(29-3)30(26,27)20-7-4-6-17(16-20)21(25)24-13-5-12-23(14-15-24)18-8-10-19(28-2)11-9-18/h4,6-11,16H,5,12-15H2,1-3H3 |
| InChIKey | LDQQDNILBWFMBT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|