C19H24N4O4S — CID 9226742
N-methoxy-N-methyl-3-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 9226742) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-methoxy-N-methyl-3-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-methoxy-N-methyl-3-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9226742 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-methoxy-N-methyl-3-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)N2CCN(Cc3ccncc3)CC2)c1 |
| InChI | InChI=1S/C19H24N4O4S/c1-21(27-2)28(25,26)18-5-3-4-17(14-18)19(24)23-12-10-22(11-13-23)15-16-6-8-20-9-7-16/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | HFHCKACXFPWPPV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|