C18H28N2O4S — CID 52517146
3-[(2R)-2-(2,2-dimethylpropyl)pyrrolidine-1-carbonyl]-N-methoxy-N-methylbenzenesulfonamide (PubChem CID 52517146) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-[(2R)-2-(2,2-dimethylpropyl)pyrrolidine-1-carbonyl]-N-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 3-[(2R)-2-(2,2-dimethylpropyl)pyrrolidine-1-carbonyl]-N-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 52517146 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-[(2R)-2-(2,2-dimethylpropyl)pyrrolidine-1-carbonyl]-N-methoxy-N-methylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)N2CCC[C@@H]2CC(C)(C)C)c1 |
| InChI | InChI=1S/C18H28N2O4S/c1-18(2,3)13-15-9-7-11-20(15)17(21)14-8-6-10-16(12-14)25(22,23)19(4)24-5/h6,8,10,12,15H,7,9,11,13H2,1-5H3/t15-/m1/s1 |
| InChIKey | VIPBKGKGQJVPNL-OAHLLOKOSA-N |
| XLogP | 2.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|