C22H25N3O4S — CID 55956568
4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-N-prop-2-ynylbenzenesulfonamide (PubChem CID 55956568) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 55956568 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)N2CCCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-3-13-23-30(27,28)21-11-5-18(6-12-21)22(26)25-15-4-14-24(16-17-25)19-7-9-20(29-2)10-8-19/h1,5-12,23H,4,13-17H2,2H3 |
| InChIKey | BTFGNIPYANAWGD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|