C26H29N3O3S — CID 25362186
3-[[(1S)-1-phenylethyl]sulfamoyl]-N-(4-piperidin-1-ylphenyl)benzamide (PubChem CID 25362186) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 3-[[(1S)-1-phenylethyl]sulfamoyl]-N-(4-piperidin-1-ylphenyl)benzamide.
| Compound Name | 3-[[(1S)-1-phenylethyl]sulfamoyl]-N-(4-piperidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 25362186 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-[[(1S)-1-phenylethyl]sulfamoyl]-N-(4-piperidin-1-ylphenyl)benzamide |
| SMILES | C[C@H](NS(=O)(=O)c1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O3S/c1-20(21-9-4-2-5-10-21)28-33(31,32)25-12-8-11-22(19-25)26(30)27-23-13-15-24(16-14-23)29-17-6-3-7-18-29/h2,4-5,8-16,19-20,28H,3,6-7,17-18H2,1H3,(H,27,30)/t20-/m0/s1 |
| InChIKey | LZRBPHPLIXYJCV-FQEVSTJZSA-N |
| XLogP | 4.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|