C23H20N2O3S — CID 26010937
N-(3-ethynylphenyl)-3-[[(1R)-1-phenylethyl]sulfamoyl]benzamide (PubChem CID 26010937) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-3-[[(1R)-1-phenylethyl]sulfamoyl]benzamide.
| Compound Name | N-(3-ethynylphenyl)-3-[[(1R)-1-phenylethyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 26010937 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-(3-ethynylphenyl)-3-[[(1R)-1-phenylethyl]sulfamoyl]benzamide |
| SMILES | C#Cc1cccc(NC(=O)c2cccc(S(=O)(=O)N[C@H](C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H20N2O3S/c1-3-18-9-7-13-21(15-18)24-23(26)20-12-8-14-22(16-20)29(27,28)25-17(2)19-10-5-4-6-11-19/h1,4-17,25H,2H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | AMMLHVUWJSESMY-QGZVFWFLSA-N |
| XLogP | 3.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|