C15H23N3O5S2 — CID 109063989
3-[2-(dimethylamino)ethylsulfamoyl]-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 109063989) has the molecular formula C15H23N3O5S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylsulfamoyl]-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 3-[2-(dimethylamino)ethylsulfamoyl]-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 109063989 |
| Molecular Formula | C15H23N3O5S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 3-[2-(dimethylamino)ethylsulfamoyl]-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CN(C)CCNS(=O)(=O)c1cccc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H23N3O5S2/c1-18(2)8-7-16-25(22,23)14-5-3-4-12(10-14)15(19)17-13-6-9-24(20,21)11-13/h3-5,10,13,16H,6-9,11H2,1-2H3,(H,17,19) |
| InChIKey | XKSAXAYFHDOZBK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |