C16H22ClNO5S — CID 51923190
3-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-5-ethoxy-4-propoxybenzamide (PubChem CID 51923190) has the molecular formula C16H22ClNO5S and a molecular weight of 375.87 g/mol. Its IUPAC name is 3-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-5-ethoxy-4-propoxybenzamide.
| Compound Name | 3-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-5-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 51923190 |
| Molecular Formula | C16H22ClNO5S |
| Molecular Weight | 375.87 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-5-ethoxy-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)N[C@@H]2CCS(=O)(=O)C2)cc1OCC |
| InChI | InChI=1S/C16H22ClNO5S/c1-3-6-23-15-13(17)8-11(9-14(15)22-4-2)16(19)18-12-5-7-24(20,21)10-12/h8-9,12H,3-7,10H2,1-2H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | CJKBQSDNMVLERP-GFCCVEGCSA-N |
| XLogP | 2.44 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.87 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |