C10H11ClN2O6S2 — CID 43389408
2-chloro-N-(1,1-dioxothiolan-3-yl)-5-nitrobenzenesulfonamide (PubChem CID 43389408) has the molecular formula C10H11ClN2O6S2 and a molecular weight of 354.79 g/mol. Its IUPAC name is 2-chloro-N-(1,1-dioxothiolan-3-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43389408 |
| Molecular Formula | C10H11ClN2O6S2 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-5-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(S(=O)(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C10H11ClN2O6S2/c11-9-2-1-8(13(14)15)5-10(9)21(18,19)12-7-3-4-20(16,17)6-7/h1-2,5,7,12H,3-4,6H2 |
| InChIKey | QWFNMVVUPQMKQR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|