C11H15ClN2O4S2 — CID 106059892
3-(aminomethyl)-4-chloro-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide (PubChem CID 106059892) has the molecular formula C11H15ClN2O4S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-chloro-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106059892 |
| Molecular Formula | C11H15ClN2O4S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NC2CCS(=O)(=O)C2)ccc1Cl |
| InChI | InChI=1S/C11H15ClN2O4S2/c12-11-2-1-10(5-8(11)6-13)20(17,18)14-9-3-4-19(15,16)7-9/h1-2,5,9,14H,3-4,6-7,13H2 |
| InChIKey | DBGZYVNDORYRCU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |