C16H21ClN2O2 — CID 108503660
N-(5-chloro-2-methylphenyl)-N'-cyclohexyl-N'-methyloxamide (PubChem CID 108503660) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N'-cyclohexyl-N'-methyloxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-N'-cyclohexyl-N'-methyloxamide |
|---|---|
| PubChem CID | 108503660 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N'-cyclohexyl-N'-methyloxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C16H21ClN2O2/c1-11-8-9-12(17)10-14(11)18-15(20)16(21)19(2)13-6-4-3-5-7-13/h8-10,13H,3-7H2,1-2H3,(H,18,20) |
| InChIKey | KWCSQSLNNGLUQP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|