C26H34N4O2 — CID 97308062
(3R)-3-(N,4-dimethylanilino)-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]piperidine-1-carboxamide (PubChem CID 97308062) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is (3R)-3-(N,4-dimethylanilino)-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(N,4-dimethylanilino)-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97308062 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (3R)-3-(N,4-dimethylanilino)-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(N(C)[C@@H]2CCCN(C(=O)Nc3cccc(C)c3C(=O)N3CCCC3)C2)cc1 |
| InChI | InChI=1S/C26H34N4O2/c1-19-11-13-21(14-12-19)28(3)22-9-7-17-30(18-22)26(32)27-23-10-6-8-20(2)24(23)25(31)29-15-4-5-16-29/h6,8,10-14,22H,4-5,7,9,15-18H2,1-3H3,(H,27,32)/t22-/m1/s1 |
| InChIKey | HLBZFDUYWIJEEF-JOCHJYFZSA-N |
| XLogP | 4.67 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|