C12H15F2N3O — CID 82755862
(2R)-N-(2,4-difluorophenyl)-2-methylpiperazine-1-carboxamide (PubChem CID 82755862) has the molecular formula C12H15F2N3O and a molecular weight of 255.27 g/mol. Its IUPAC name is (2R)-N-(2,4-difluorophenyl)-2-methylpiperazine-1-carboxamide.
| Compound Name | (2R)-N-(2,4-difluorophenyl)-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 82755862 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (2R)-N-(2,4-difluorophenyl)-2-methylpiperazine-1-carboxamide |
| SMILES | C[C@@H]1CNCCN1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2N3O/c1-8-7-15-4-5-17(8)12(18)16-11-3-2-9(13)6-10(11)14/h2-3,6,8,15H,4-5,7H2,1H3,(H,16,18)/t8-/m1/s1 |
| InChIKey | YMYZKWKPOFEATK-MRVPVSSYSA-N |
| XLogP | 1.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |