C21H18BrF2N5O — CID 53010095
N-(4-bromo-2-fluorophenyl)-4-[6-(4-fluorophenyl)pyrimidin-4-yl]piperazine-1-carboxamide (PubChem CID 53010095) has the molecular formula C21H18BrF2N5O and a molecular weight of 474.31 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-[6-(4-fluorophenyl)pyrimidin-4-yl]piperazine-1-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-[6-(4-fluorophenyl)pyrimidin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 53010095 |
| Molecular Formula | C21H18BrF2N5O |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-[6-(4-fluorophenyl)pyrimidin-4-yl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)N1CCN(c2cc(-c3ccc(F)cc3)ncn2)CC1 |
| InChI | InChI=1S/C21H18BrF2N5O/c22-15-3-6-18(17(24)11-15)27-21(30)29-9-7-28(8-10-29)20-12-19(25-13-26-20)14-1-4-16(23)5-2-14/h1-6,11-13H,7-10H2,(H,27,30) |
| InChIKey | IEXHXWNQTCLNKI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |