C13H16BrN3O3 — CID 62074359
5-bromo-2-[(4-methylpiperazine-1-carbonyl)amino]benzoic acid (PubChem CID 62074359) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is 5-bromo-2-[(4-methylpiperazine-1-carbonyl)amino]benzoic acid.
| Compound Name | 5-bromo-2-[(4-methylpiperazine-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 62074359 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 5-bromo-2-[(4-methylpiperazine-1-carbonyl)amino]benzoic acid |
| SMILES | CN1CCN(C(=O)Nc2ccc(Br)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C13H16BrN3O3/c1-16-4-6-17(7-5-16)13(20)15-11-3-2-9(14)8-10(11)12(18)19/h2-3,8H,4-7H2,1H3,(H,15,20)(H,18,19) |
| InChIKey | NUNBWIGEYQFNHU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |