C12H14BrClFN3O — CID 163286324
N-(4-bromo-3-chloro-2-fluorophenyl)-4-methylpiperazine-1-carboxamide (PubChem CID 163286324) has the molecular formula C12H14BrClFN3O and a molecular weight of 350.62 g/mol. Its IUPAC name is N-(4-bromo-3-chloro-2-fluorophenyl)-4-methylpiperazine-1-carboxamide.
| Compound Name | N-(4-bromo-3-chloro-2-fluorophenyl)-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 163286324 |
| Molecular Formula | C12H14BrClFN3O |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-(4-bromo-3-chloro-2-fluorophenyl)-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)Nc2ccc(Br)c(Cl)c2F)CC1 |
| InChI | InChI=1S/C12H14BrClFN3O/c1-17-4-6-18(7-5-17)12(19)16-9-3-2-8(13)10(14)11(9)15/h2-3H,4-7H2,1H3,(H,16,19) |
| InChIKey | IRYDNAQYSSNJIL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|