About N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide
N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 167899386) has the molecular formula C11H14BrN3O3S
and a molecular weight of 348.22 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide.
Molecular Properties
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| PubChem CID | 167899386 |
| Molecular Formula | C11H14BrN3O3S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | Cc1nc(NC(=O)N2CCS(=O)(=O)CC2)ccc1Br |
| InChI | InChI=1S/C11H14BrN3O3S/c1-8-9(12)2-3-10(13-8)14-11(16)15-4-6-19(17,18)7-5-15/h2-3H,4-7H2,1H3,(H,13,14,16) |
| InChIKey | CMKGQIFBJORDBS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide?
The IUPAC name of N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide (CID 167899386) is N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide.
What is the SMILES notation for N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide?
The canonical SMILES for N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide is Cc1nc(NC(=O)N2CCS(=O)(=O)CC2)ccc1Br.
What is the InChIKey of N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide?
The InChIKey is CMKGQIFBJORDBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrN3O3S/c1-8-9(12)2-3-10(13-8)14-11(16)15-4-6-19(17,18)7-5-15/h2-3H,4-7H2,1H3,(H,13,14,16).
What are the key properties of N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide?
N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide has a molecular weight of 348.22 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-6-methyl-2-pyridinyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide is sourced from PubChem (CID 167899386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).