C16H15BrN2O2 — CID 166611442
5-bromo-N-(2-methoxyphenyl)-1,3-dihydroisoindole-2-carboxamide (PubChem CID 166611442) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is 5-bromo-N-(2-methoxyphenyl)-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | 5-bromo-N-(2-methoxyphenyl)-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 166611442 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 5-bromo-N-(2-methoxyphenyl)-1,3-dihydroisoindole-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1Cc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C16H15BrN2O2/c1-21-15-5-3-2-4-14(15)18-16(20)19-9-11-6-7-13(17)8-12(11)10-19/h2-8H,9-10H2,1H3,(H,18,20) |
| InChIKey | TXSKFJJJKNWTOD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |