C19H23N3O3 — CID 119422876
N-[5-[4-(aminomethyl)piperidine-1-carbonyl]-2-methylphenyl]furan-2-carboxamide (PubChem CID 119422876) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[5-[4-(aminomethyl)piperidine-1-carbonyl]-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-[4-(aminomethyl)piperidine-1-carbonyl]-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119422876 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[5-[4-(aminomethyl)piperidine-1-carbonyl]-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCC(CN)CC2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C19H23N3O3/c1-13-4-5-15(19(24)22-8-6-14(12-20)7-9-22)11-16(13)21-18(23)17-3-2-10-25-17/h2-5,10-11,14H,6-9,12,20H2,1H3,(H,21,23) |
| InChIKey | AQLSBNJGDJLHLU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |