C16H17FN4O3 — CID 86791229
1-(3-fluoro-4-pyridinyl)-3-[1-(furan-2-carbonyl)piperidin-4-yl]urea (PubChem CID 86791229) has the molecular formula C16H17FN4O3 and a molecular weight of 332.33 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-3-[1-(furan-2-carbonyl)piperidin-4-yl]urea.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-3-[1-(furan-2-carbonyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 86791229 |
| Molecular Formula | C16H17FN4O3 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-3-[1-(furan-2-carbonyl)piperidin-4-yl]urea |
| SMILES | O=C(Nc1ccncc1F)NC1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C16H17FN4O3/c17-12-10-18-6-3-13(12)20-16(23)19-11-4-7-21(8-5-11)15(22)14-2-1-9-24-14/h1-3,6,9-11H,4-5,7-8H2,(H2,18,19,20,23) |
| InChIKey | VUGPTERPKCGGDF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |