C19H23N3O3 — CID 68909734
N-[2-oxo-2-[[(3S)-oxolan-3-yl]amino]ethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 68909734) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[2-oxo-2-[[(3S)-oxolan-3-yl]amino]ethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[2-oxo-2-[[(3S)-oxolan-3-yl]amino]ethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 68909734 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[2-oxo-2-[[(3S)-oxolan-3-yl]amino]ethyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc2[nH]c3c(c2c1)CCCC3)N[C@H]1CCOC1 |
| InChI | InChI=1S/C19H23N3O3/c23-18(21-13-7-8-25-11-13)10-20-19(24)12-5-6-17-15(9-12)14-3-1-2-4-16(14)22-17/h5-6,9,13,22H,1-4,7-8,10-11H2,(H,20,24)(H,21,23)/t13-/m0/s1 |
| InChIKey | PQFFFJWEXRAQQA-ZDUSSCGKSA-N |
| XLogP | 1.68 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|