C21H26N2O3 — CID 2449280
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 2449280) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 2449280 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | C[C@@H]1CCCCN1C(=O)COC(=O)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C21H26N2O3/c1-14-6-4-5-11-23(14)20(24)13-26-21(25)15-9-10-19-17(12-15)16-7-2-3-8-18(16)22-19/h9-10,12,14,22H,2-8,11,13H2,1H3/t14-/m1/s1 |
| InChIKey | CCPHBANAFRVKCN-CQSZACIVSA-N |
| XLogP | 3.60 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|