C18H20N2O4 — CID 7504437
[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate (PubChem CID 7504437) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate.
| Compound Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7504437 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-oxo-1H-quinoline-2-carboxylate |
| SMILES | C[C@@H]1CCCCN1C(=O)COC(=O)c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C18H20N2O4/c1-12-6-4-5-9-20(12)17(22)11-24-18(23)15-10-16(21)13-7-2-3-8-14(13)19-15/h2-3,7-8,10,12H,4-6,9,11H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | WHDVPNPKYWYSSC-GFCCVEGCSA-N |
| XLogP | 2.09 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |