C21H20F3N3O — CID 167868989
2-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide (PubChem CID 167868989) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide.
| Compound Name | 2-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
|---|---|
| PubChem CID | 167868989 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccc3[nH]c4c(c3c2)CN(C)CC4)cccc1C(F)(F)F |
| InChI | InChI=1S/C21H20F3N3O/c1-12-16(21(22,23)24)4-3-5-17(12)26-20(28)13-6-7-18-14(10-13)15-11-27(2)9-8-19(15)25-18/h3-7,10,25H,8-9,11H2,1-2H3,(H,26,28) |
| InChIKey | PKOXIFXTZRAXFI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|