C19H21N5OS — CID 154764390
N-[3-(cyclopropylmethyl)-1,2,4-thiadiazol-5-yl]-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide (PubChem CID 154764390) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is N-[3-(cyclopropylmethyl)-1,2,4-thiadiazol-5-yl]-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide.
| Compound Name | N-[3-(cyclopropylmethyl)-1,2,4-thiadiazol-5-yl]-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
|---|---|
| PubChem CID | 154764390 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[3-(cyclopropylmethyl)-1,2,4-thiadiazol-5-yl]-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxamide |
| SMILES | CN1CCc2[nH]c3ccc(C(=O)Nc4nc(CC5CC5)ns4)cc3c2C1 |
| InChI | InChI=1S/C19H21N5OS/c1-24-7-6-16-14(10-24)13-9-12(4-5-15(13)20-16)18(25)22-19-21-17(23-26-19)8-11-2-3-11/h4-5,9,11,20H,2-3,6-8,10H2,1H3,(H,21,22,23,25) |
| InChIKey | NOTCHFWFHFBAIS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|